C23H26N2O — CID 70473466
[(1R,12bR)-12b-methyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]-phenylmethanol (PubChem CID 70473466) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is [(1R,12bR)-12b-methyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]-phenylmethanol.
| Compound Name | [(1R,12bR)-12b-methyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]-phenylmethanol |
|---|---|
| PubChem CID | 70473466 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | [(1R,12bR)-12b-methyl-2,3,4,6,7,12-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]-phenylmethanol |
| SMILES | C[C@@]12c3[nH]c4ccccc4c3CCN1CCC[C@H]2C(O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O/c1-23-19(21(26)16-8-3-2-4-9-16)11-7-14-25(23)15-13-18-17-10-5-6-12-20(17)24-22(18)23/h2-6,8-10,12,19,21,24,26H,7,11,13-15H2,1H3/t19-,21?,23+/m0/s1 |
| InChIKey | YSOLFXDHXYSWJB-AVAATZNPSA-N |
| XLogP | 4.38 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |