C22H28N2O5 — CID 10250386
methyl 3-[3-ethyl-1-[2-(1-methyl-2,3-dihydroindol-3-yl)acetyl]-2-oxopiperidin-3-yl]-3-oxopropanoate (PubChem CID 10250386) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is methyl 3-[3-ethyl-1-[2-(1-methyl-2,3-dihydroindol-3-yl)acetyl]-2-oxopiperidin-3-yl]-3-oxopropanoate.
| Compound Name | methyl 3-[3-ethyl-1-[2-(1-methyl-2,3-dihydroindol-3-yl)acetyl]-2-oxopiperidin-3-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 10250386 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl 3-[3-ethyl-1-[2-(1-methyl-2,3-dihydroindol-3-yl)acetyl]-2-oxopiperidin-3-yl]-3-oxopropanoate |
| SMILES | CCC1(C(=O)CC(=O)OC)CCCN(C(=O)CC2CN(C)c3ccccc32)C1=O |
| InChI | InChI=1S/C22H28N2O5/c1-4-22(18(25)13-20(27)29-3)10-7-11-24(21(22)28)19(26)12-15-14-23(2)17-9-6-5-8-16(15)17/h5-6,8-9,15H,4,7,10-14H2,1-3H3 |
| InChIKey | HZEMEEWJUCYPAM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|