C14H15NO5 — CID 155807601
13,14,15-trihydroxy-16-oxa-5-azatetracyclo[10.3.1.01,5.06,11]hexadeca-6,8,10-trien-4-one (PubChem CID 155807601) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 13,14,15-trihydroxy-16-oxa-5-azatetracyclo[10.3.1.01,5.06,11]hexadeca-6,8,10-trien-4-one.
| Compound Name | 13,14,15-trihydroxy-16-oxa-5-azatetracyclo[10.3.1.01,5.06,11]hexadeca-6,8,10-trien-4-one |
|---|---|
| PubChem CID | 155807601 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 13,14,15-trihydroxy-16-oxa-5-azatetracyclo[10.3.1.01,5.06,11]hexadeca-6,8,10-trien-4-one |
| SMILES | O=C1CCC23OC(c4ccccc4N12)C(O)C(O)C3O |
| InChI | InChI=1S/C14H15NO5/c16-9-5-6-14-13(19)11(18)10(17)12(20-14)7-3-1-2-4-8(7)15(9)14/h1-4,10-13,17-19H,5-6H2 |
| InChIKey | BTWOCTBBLDAPGF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |