About tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate
tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate (PubChem CID 134954246) has the molecular formula C19H23NO3S
and a molecular weight of 345.46 g/mol. Its IUPAC name is tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate |
| PubChem CID | 134954246 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate |
| SMILES | COc1ccc(/C=C/[C@@H](NC(=O)OC(C)(C)C)c2cccs2)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-19(2,3)23-18(21)20-16(17-6-5-13-24-17)12-9-14-7-10-15(22-4)11-8-14/h5-13,16H,1-4H3,(H,20,21)/b12-9+/t16-/m1/s1 |
| InChIKey | POEWTKZHGKDXEJ-ONOODXEBSA-N |
| XLogP | 5.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate?
The IUPAC name of tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate (CID 134954246) is tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate.
What is the SMILES notation for tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate?
The canonical SMILES for tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate is COc1ccc(/C=C/[C@@H](NC(=O)OC(C)(C)C)c2cccs2)cc1.
What is the InChIKey of tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate?
The InChIKey is POEWTKZHGKDXEJ-ONOODXEBSA-N. The full InChI is InChI=1S/C19H23NO3S/c1-19(2,3)23-18(21)20-16(17-6-5-13-24-17)12-9-14-7-10-15(22-4)11-8-14/h5-13,16H,1-4H3,(H,20,21)/b12-9+/t16-/m1/s1.
What are the key properties of tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate?
tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate has a molecular weight of 345.46 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,1R)-3-(4-methoxyphenyl)-1-thiophen-2-ylprop-2-enyl]carbamate is sourced from PubChem (CID 134954246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).