C57H27F9O12S3 — CID 134954940
[8-[2-[3,5-bis[2-[8-(trifluoromethylsulfonyloxy)anthracen-1-yl]oxyethynyl]phenyl]ethynoxy]anthracen-1-yl] trifluoromethanesulfonate (PubChem CID 134954940) has the molecular formula C57H27F9O12S3 and a molecular weight of 1171.01 g/mol. Its IUPAC name is [8-[2-[3,5-bis[2-[8-(trifluoromethylsulfonyloxy)anthracen-1-yl]oxyethynyl]phenyl]ethynoxy]anthracen-1-yl] trifluoromethanesulfonate.
| Compound Name | [8-[2-[3,5-bis[2-[8-(trifluoromethylsulfonyloxy)anthracen-1-yl]oxyethynyl]phenyl]ethynoxy]anthracen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134954940 |
| Molecular Formula | C57H27F9O12S3 |
| Molecular Weight | 1171.01 g/mol |
| Exact Mass | 1170.05 |
| IUPAC Name | [8-[2-[3,5-bis[2-[8-(trifluoromethylsulfonyloxy)anthracen-1-yl]oxyethynyl]phenyl]ethynoxy]anthracen-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc2cc3cccc(OC#Cc4cc(C#COc5cccc6cc7cccc(OS(=O)(=O)C(F)(F)F)c7cc56)cc(C#COc5cccc6cc7cccc(OS(=O)(=O)C(F)(F)F)c7cc56)c4)c3cc12)C(F)(F)F |
| InChI | InChI=1S/C57H27F9O12S3/c58-55(59,60)79(67,68)76-52-16-4-10-40-28-37-7-1-13-49(43(37)31-46(40)52)73-22-19-34-25-35(20-23-74-50-14-2-8-38-29-41-11-5-17-53(47(41)32-44(38)50)77-80(69,70)56(61,62)63)27-36(26-34)21-24-75-51-15-3-9-39-30-42-12-6-18-54(48(42)33-45(39)51)78-81(71,72)57(64,65)66/h1-18,25-33H |
| InChIKey | MLFKEIQQZOGEDI-UHFFFAOYSA-N |
| XLogP | 13.45 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1171.01 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|