C23H24F2N2 — CID 134954990
2-[4-(1,1-difluoro-5-phenylpentyl)phenyl]-4,6-dimethylpyrimidine (PubChem CID 134954990) has the molecular formula C23H24F2N2 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[4-(1,1-difluoro-5-phenylpentyl)phenyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[4-(1,1-difluoro-5-phenylpentyl)phenyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 134954990 |
| Molecular Formula | C23H24F2N2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[4-(1,1-difluoro-5-phenylpentyl)phenyl]-4,6-dimethylpyrimidine |
| SMILES | Cc1cc(C)nc(-c2ccc(C(F)(F)CCCCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H24F2N2/c1-17-16-18(2)27-22(26-17)20-11-13-21(14-12-20)23(24,25)15-7-6-10-19-8-4-3-5-9-19/h3-5,8-9,11-14,16H,6-7,10,15H2,1-2H3 |
| InChIKey | KNLRGLSKGBMRCN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|