C21H21F4NO3S — CID 134955317
N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)-3-hydroxybut-1-ynyl]benzenesulfonamide (PubChem CID 134955317) has the molecular formula C21H21F4NO3S and a molecular weight of 443.46 g/mol. Its IUPAC name is N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)-3-hydroxybut-1-ynyl]benzenesulfonamide.
| Compound Name | N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)-3-hydroxybut-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134955317 |
| Molecular Formula | C21H21F4NO3S |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-butyl-4-methyl-N-[(3R)-4,4,4-trifluoro-3-(4-fluorophenyl)-3-hydroxybut-1-ynyl]benzenesulfonamide |
| SMILES | CCCCN(C#C[C@](O)(c1ccc(F)cc1)C(F)(F)F)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21F4NO3S/c1-3-4-14-26(30(28,29)19-11-5-16(2)6-12-19)15-13-20(27,21(23,24)25)17-7-9-18(22)10-8-17/h5-12,27H,3-4,14H2,1-2H3/t20-/m0/s1 |
| InChIKey | DNOSGRPGHAPRTK-FQEVSTJZSA-N |
| XLogP | 4.34 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|