C15H16O3 — CID 134955380
(2S)-2-[(2S,3S,3aS,6aR)-4-ethynyl-3-methyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]-4-methyl-2H-furan-5-one (PubChem CID 134955380) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-[(2S,3S,3aS,6aR)-4-ethynyl-3-methyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]-4-methyl-2H-furan-5-one.
| Compound Name | (2S)-2-[(2S,3S,3aS,6aR)-4-ethynyl-3-methyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]-4-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 134955380 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2S)-2-[(2S,3S,3aS,6aR)-4-ethynyl-3-methyl-3,3a,6,6a-tetrahydro-2H-cyclopenta[b]furan-2-yl]-4-methyl-2H-furan-5-one |
| SMILES | C#CC1=CC[C@H]2O[C@H]([C@@H]3C=C(C)C(=O)O3)[C@@H](C)[C@@H]12 |
| InChI | InChI=1S/C15H16O3/c1-4-10-5-6-11-13(10)9(3)14(17-11)12-7-8(2)15(16)18-12/h1,5,7,9,11-14H,6H2,2-3H3/t9-,11+,12-,13-,14-/m0/s1 |
| InChIKey | RHIVRWPDJWCRMN-SWTDPAGASA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|