C15H16O4 — CID 163038259
5,14-dimethyl-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadeca-8,13-diene-4,10-dione (PubChem CID 163038259) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5,14-dimethyl-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadeca-8,13-diene-4,10-dione.
| Compound Name | 5,14-dimethyl-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadeca-8,13-diene-4,10-dione |
|---|---|
| PubChem CID | 163038259 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5,14-dimethyl-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadeca-8,13-diene-4,10-dione |
| SMILES | CC1=CC2OC(=O)C3=CCC4C(C)C(=O)OC4C1C32 |
| InChI | InChI=1S/C15H16O4/c1-6-5-10-12-9(15(17)18-10)4-3-8-7(2)14(16)19-13(8)11(6)12/h4-5,7-8,10-13H,3H2,1-2H3 |
| InChIKey | XTDSTEKGYMFRGR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|