C23H17FN4O2 — CID 134955414
(2R,3R)-2-[(S)-azido(phenyl)methyl]-5-(4-fluorophenyl)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 134955414) has the molecular formula C23H17FN4O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is (2R,3R)-2-[(S)-azido(phenyl)methyl]-5-(4-fluorophenyl)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one.
| Compound Name | (2R,3R)-2-[(S)-azido(phenyl)methyl]-5-(4-fluorophenyl)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 134955414 |
| Molecular Formula | C23H17FN4O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2R,3R)-2-[(S)-azido(phenyl)methyl]-5-(4-fluorophenyl)-3-phenyl-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | [N-]=[N+]=N[C@@H](c1ccccc1)[C@@H]1OC(=O)C(c2ccc(F)cc2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H17FN4O2/c24-18-13-11-17(12-14-18)21-23(29)30-22(19(26-21)15-7-3-1-4-8-15)20(27-28-25)16-9-5-2-6-10-16/h1-14,19-20,22H/t19-,20+,22-/m1/s1 |
| InChIKey | YQABKPYGLOKOMZ-RZUBCFFCSA-N |
| XLogP | 5.33 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|