C11H9FN4O2 — CID 102340546
(2S)-2-(azidomethyl)-5-(4-fluorophenyl)-2,3-dihydro-1,4-oxazin-6-one (PubChem CID 102340546) has the molecular formula C11H9FN4O2 and a molecular weight of 248.22 g/mol. Its IUPAC name is (2S)-2-(azidomethyl)-5-(4-fluorophenyl)-2,3-dihydro-1,4-oxazin-6-one.
| Compound Name | (2S)-2-(azidomethyl)-5-(4-fluorophenyl)-2,3-dihydro-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 102340546 |
| Molecular Formula | C11H9FN4O2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (2S)-2-(azidomethyl)-5-(4-fluorophenyl)-2,3-dihydro-1,4-oxazin-6-one |
| SMILES | [N-]=[N+]=NC[C@@H]1CN=C(c2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C11H9FN4O2/c12-8-3-1-7(2-4-8)10-11(17)18-9(5-14-10)6-15-16-13/h1-4,9H,5-6H2/t9-/m0/s1 |
| InChIKey | NSDGGROXCBWLEG-VIFPVBQESA-N |
| XLogP | 1.85 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|