C14H10F4N2 — CID 134955799
8-benzyl-5,5,6,6-tetrafluoroimidazo[1,5-a]pyridine (PubChem CID 134955799) has the molecular formula C14H10F4N2 and a molecular weight of 282.24 g/mol. Its IUPAC name is 8-benzyl-5,5,6,6-tetrafluoroimidazo[1,5-a]pyridine.
| Compound Name | 8-benzyl-5,5,6,6-tetrafluoroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 134955799 |
| Molecular Formula | C14H10F4N2 |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 8-benzyl-5,5,6,6-tetrafluoroimidazo[1,5-a]pyridine |
| SMILES | FC1(F)C=C(Cc2ccccc2)c2cncn2C1(F)F |
| InChI | InChI=1S/C14H10F4N2/c15-13(16)7-11(6-10-4-2-1-3-5-10)12-8-19-9-20(12)14(13,17)18/h1-5,7-9H,6H2 |
| InChIKey | ORRFEKNYPGRXAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|