C24H44O2Si — CID 134955928
(3aS,5aS,7R,9aR,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-2,3a,6,6,9a-pentamethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one (PubChem CID 134955928) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is (3aS,5aS,7R,9aR,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-2,3a,6,6,9a-pentamethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one.
| Compound Name | (3aS,5aS,7R,9aR,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-2,3a,6,6,9a-pentamethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 134955928 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | (3aS,5aS,7R,9aR,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-2,3a,6,6,9a-pentamethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-3-one |
| SMILES | CC1C[C@H]2[C@]3(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C24H44O2Si/c1-16-15-18-23(7)14-12-19(26-27(9,10)21(2,3)4)22(5,6)17(23)11-13-24(18,8)20(16)25/h16-19H,11-15H2,1-10H3/t16?,17-,18+,19-,23-,24+/m1/s1 |
| InChIKey | BRQDJIUQZDBFAB-VIGYFQBTSA-N |
| XLogP | 6.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|