C9H9F3O3 — CID 134956675
(3R)-3-prop-2-enyl-3-(2,2,2-trifluoroacetyl)oxolan-2-one (PubChem CID 134956675) has the molecular formula C9H9F3O3 and a molecular weight of 222.16 g/mol. Its IUPAC name is (3R)-3-prop-2-enyl-3-(2,2,2-trifluoroacetyl)oxolan-2-one.
| Compound Name | (3R)-3-prop-2-enyl-3-(2,2,2-trifluoroacetyl)oxolan-2-one |
|---|---|
| PubChem CID | 134956675 |
| Molecular Formula | C9H9F3O3 |
| Molecular Weight | 222.16 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (3R)-3-prop-2-enyl-3-(2,2,2-trifluoroacetyl)oxolan-2-one |
| SMILES | C=CC[C@]1(C(=O)C(F)(F)F)CCOC1=O |
| InChI | InChI=1S/C9H9F3O3/c1-2-3-8(4-5-15-7(8)14)6(13)9(10,11)12/h2H,1,3-5H2/t8-/m1/s1 |
| InChIKey | WLWQMJSEIRBVGX-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|