C17H17NO3 — CID 134957235
CID 134957235 (PubChem CID 134957235) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol.
| Compound Name | CID 134957235 |
|---|---|
| PubChem CID | 134957235 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)[C@@]1(C=C[C@@]3(CCCC3=O)O1)C(=O)N2C |
| InChI | InChI=1S/C17H17NO3/c1-11-5-6-13-12(10-11)17(15(20)18(13)2)9-8-16(21-17)7-3-4-14(16)19/h5-6,8-10H,3-4,7H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | MUQZNJFCEDYUED-SJORKVTESA-N |
| XLogP | 2.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|