C16H19FO4 — CID 134957311
methyl (3S,4R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2-oxooxolane-3-carboxylate (PubChem CID 134957311) has the molecular formula C16H19FO4 and a molecular weight of 294.32 g/mol. Its IUPAC name is methyl (3S,4R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2-oxooxolane-3-carboxylate.
| Compound Name | methyl (3S,4R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 134957311 |
| Molecular Formula | C16H19FO4 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl (3S,4R)-4-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)OC[C@@H]1[C@H](c1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C16H19FO4/c1-9(2)13(10-4-6-11(17)7-5-10)12-8-21-16(19)14(12)15(18)20-3/h4-7,9,12-14H,8H2,1-3H3/t12-,13+,14+/m1/s1 |
| InChIKey | AKEGBCGIFORQBV-RDBSUJKOSA-N |
| XLogP | 2.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|