C29H23F3NOP — CID 134957965
[2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-diphenylphosphane (PubChem CID 134957965) has the molecular formula C29H23F3NOP and a molecular weight of 489.48 g/mol. Its IUPAC name is [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-diphenylphosphane.
| Compound Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 134957965 |
| Molecular Formula | C29H23F3NOP |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | [2-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]-4-(trifluoromethyl)phenyl]-diphenylphosphane |
| SMILES | FC(F)(F)c1ccc(P(c2ccccc2)c2ccccc2)c(C2=N[C@@H](Cc3ccccc3)CO2)c1 |
| InChI | InChI=1S/C29H23F3NOP/c30-29(31,32)22-16-17-27(35(24-12-6-2-7-13-24)25-14-8-3-9-15-25)26(19-22)28-33-23(20-34-28)18-21-10-4-1-5-11-21/h1-17,19,23H,18,20H2/t23-/m0/s1 |
| InChIKey | XYQVUIQHVMNEHZ-QHCPKHFHSA-N |
| XLogP | 5.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|