C40H22Br2 — CID 134958993
(1R,2R,19R,20R)-1,2-dibromoundecacyclo[18.16.2.29,12.02,10.03,8.011,19.013,18.021,26.027,38.030,37.031,36]tetraconta-3,5,7,9,11,13,15,17,21,23,25,27(38),28,30(37),31,33,35,39-octadecaene (PubChem CID 134958993) has the molecular formula C40H22Br2 and a molecular weight of 662.42 g/mol. Its IUPAC name is (1R,2R,19R,20R)-1,2-dibromoundecacyclo[18.16.2.29,12.02,10.03,8.011,19.013,18.021,26.027,38.030,37.031,36]tetraconta-3,5,7,9,11,13,15,17,21,23,25,27(38),28,30(37),31,33,35,39-octadecaene.
| Compound Name | (1R,2R,19R,20R)-1,2-dibromoundecacyclo[18.16.2.29,12.02,10.03,8.011,19.013,18.021,26.027,38.030,37.031,36]tetraconta-3,5,7,9,11,13,15,17,21,23,25,27(38),28,30(37),31,33,35,39-octadecaene |
|---|---|
| PubChem CID | 134958993 |
| Molecular Formula | C40H22Br2 |
| Molecular Weight | 662.42 g/mol |
| Exact Mass | 660.01 |
| IUPAC Name | (1R,2R,19R,20R)-1,2-dibromoundecacyclo[18.16.2.29,12.02,10.03,8.011,19.013,18.021,26.027,38.030,37.031,36]tetraconta-3,5,7,9,11,13,15,17,21,23,25,27(38),28,30(37),31,33,35,39-octadecaene |
| SMILES | Br[C@]12c3ccccc3-c3ccc4c(c31)[C@@H](c1ccccc1-4)[C@@H]1c3ccccc3-c3ccc4c(c31)[C@]2(Br)c1ccccc1-4 |
| InChI | InChI=1S/C40H22Br2/c41-39-31-15-7-5-11-23(31)29-19-17-27-21-9-1-3-13-25(21)33(35(27)37(29)39)34-26-14-4-2-10-22(26)28-18-20-30-24-12-6-8-16-32(24)40(39,42)38(30)36(28)34/h1-20,33-34H/t33-,34-,39+,40+/m0/s1 |
| InChIKey | VSYQQXDDSBXTRE-HVQZGMPCSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.42 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|