C8H4F4O2S2 — CID 134959115
2,4,5,6-tetrafluoro-3λ6,10-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,3-dioxide (PubChem CID 134959115) has the molecular formula C8H4F4O2S2 and a molecular weight of 272.24 g/mol. Its IUPAC name is 2,4,5,6-tetrafluoro-3λ6,10-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,3-dioxide.
| Compound Name | 2,4,5,6-tetrafluoro-3λ6,10-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,3-dioxide |
|---|---|
| PubChem CID | 134959115 |
| Molecular Formula | C8H4F4O2S2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 2,4,5,6-tetrafluoro-3λ6,10-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,3-dioxide |
| SMILES | O=S1(=O)C(F)=C(F)C2(F)C3C=CC(S3)C21F |
| InChI | InChI=1S/C8H4F4O2S2/c9-5-6(10)16(13,14)8(12)4-2-1-3(15-4)7(5,8)11/h1-4H |
| InChIKey | QLFYSXQBWZGXRQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|