C8H8O2S2 — CID 42615046
(1S,2S,3S,6S)-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide (PubChem CID 42615046) has the molecular formula C8H8O2S2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (1S,2S,3S,6S)-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide.
| Compound Name | (1S,2S,3S,6S)-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
|---|---|
| PubChem CID | 42615046 |
| Molecular Formula | C8H8O2S2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | (1S,2S,3S,6S)-3λ4,10λ4-dithiatricyclo[5.2.1.02,6]deca-4,8-diene 3,10-dioxide |
| SMILES | O=S1C2C=C[C@H]1[C@@H]1[C@H]2C=C[S@@]1=O |
| InChI | InChI=1S/C8H8O2S2/c9-11-4-3-5-6-1-2-7(8(5)11)12(6)10/h1-8H/t5-,6?,7-,8-,11-,12?/m0/s1 |
| InChIKey | JMIGHUJYNKFKSK-ZMEDFWBISA-N |
| XLogP | 0.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|