C24H20O4 — CID 134959139
dimethyl 2-phenyl-5-[(E)-2-phenylethenyl]benzene-1,4-dicarboxylate (PubChem CID 134959139) has the molecular formula C24H20O4 and a molecular weight of 372.42 g/mol. Its IUPAC name is dimethyl 2-phenyl-5-[(E)-2-phenylethenyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-phenyl-5-[(E)-2-phenylethenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134959139 |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | dimethyl 2-phenyl-5-[(E)-2-phenylethenyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)c(C(=O)OC)cc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H20O4/c1-27-23(25)21-16-20(18-11-7-4-8-12-18)22(24(26)28-2)15-19(21)14-13-17-9-5-3-6-10-17/h3-16H,1-2H3/b14-13+ |
| InChIKey | LNUOZULJUJTLTK-BUHFOSPRSA-N |
| XLogP | 5.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|