C7H9N3O2 — CID 13495930
3,4,4-trimethyl-2,5-dioxoimidazolidine-1-carbonitrile (PubChem CID 13495930) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 3,4,4-trimethyl-2,5-dioxoimidazolidine-1-carbonitrile.
| Compound Name | 3,4,4-trimethyl-2,5-dioxoimidazolidine-1-carbonitrile |
|---|---|
| PubChem CID | 13495930 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3,4,4-trimethyl-2,5-dioxoimidazolidine-1-carbonitrile |
| SMILES | CN1C(=O)N(C#N)C(=O)C1(C)C |
| InChI | InChI=1S/C7H9N3O2/c1-7(2)5(11)10(4-8)6(12)9(7)3/h1-3H3 |
| InChIKey | CECDZIOTMSFRSQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|