C11H11ClO — CID 134959730
(1S)-6-chloro-1-ethenyl-3,4-dihydro-1H-isochromene (PubChem CID 134959730) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is (1S)-6-chloro-1-ethenyl-3,4-dihydro-1H-isochromene.
| Compound Name | (1S)-6-chloro-1-ethenyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 134959730 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (1S)-6-chloro-1-ethenyl-3,4-dihydro-1H-isochromene |
| SMILES | C=C[C@@H]1OCCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H11ClO/c1-2-11-10-4-3-9(12)7-8(10)5-6-13-11/h2-4,7,11H,1,5-6H2/t11-/m0/s1 |
| InChIKey | WDLSRWPTVMFKIY-NSHDSACASA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|