C22H22O2 — CID 134959833
(3aS,6aS)-3a-hydroxy-6a-methyl-4-(3-methylphenyl)-5-phenyl-3,6-dihydro-2H-pentalen-1-one (PubChem CID 134959833) has the molecular formula C22H22O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3aS,6aS)-3a-hydroxy-6a-methyl-4-(3-methylphenyl)-5-phenyl-3,6-dihydro-2H-pentalen-1-one.
| Compound Name | (3aS,6aS)-3a-hydroxy-6a-methyl-4-(3-methylphenyl)-5-phenyl-3,6-dihydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 134959833 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (3aS,6aS)-3a-hydroxy-6a-methyl-4-(3-methylphenyl)-5-phenyl-3,6-dihydro-2H-pentalen-1-one |
| SMILES | Cc1cccc(C2=C(c3ccccc3)C[C@]3(C)C(=O)CC[C@]23O)c1 |
| InChI | InChI=1S/C22H22O2/c1-15-7-6-10-17(13-15)20-18(16-8-4-3-5-9-16)14-21(2)19(23)11-12-22(20,21)24/h3-10,13,24H,11-12,14H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | CAPMQTOQTQLZGO-YADHBBJMSA-N |
| XLogP | 4.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|