C18H16O2 — CID 57422037
4-hydroxy-2-methyl-3,4-diphenylcyclopent-2-en-1-one (PubChem CID 57422037) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-3,4-diphenylcyclopent-2-en-1-one.
| Compound Name | 4-hydroxy-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 57422037 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-hydroxy-2-methyl-3,4-diphenylcyclopent-2-en-1-one |
| SMILES | CC1=C(c2ccccc2)C(O)(c2ccccc2)CC1=O |
| InChI | InChI=1S/C18H16O2/c1-13-16(19)12-18(20,15-10-6-3-7-11-15)17(13)14-8-4-2-5-9-14/h2-11,20H,12H2,1H3 |
| InChIKey | QHTSZFGLTOSSQJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |