C17H18FNO3 — CID 134960113
methyl (2R,3S)-3-amino-3-(4-fluorophenyl)-2-phenylmethoxypropanoate (PubChem CID 134960113) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is methyl (2R,3S)-3-amino-3-(4-fluorophenyl)-2-phenylmethoxypropanoate.
| Compound Name | methyl (2R,3S)-3-amino-3-(4-fluorophenyl)-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 134960113 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl (2R,3S)-3-amino-3-(4-fluorophenyl)-2-phenylmethoxypropanoate |
| SMILES | COC(=O)[C@H](OCc1ccccc1)[C@@H](N)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO3/c1-21-17(20)16(22-11-12-5-3-2-4-6-12)15(19)13-7-9-14(18)10-8-13/h2-10,15-16H,11,19H2,1H3/t15-,16+/m0/s1 |
| InChIKey | CKKKJZKLHAYYEV-JKSUJKDBSA-N |
| XLogP | 2.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |