C19H32O4Si — CID 134960855
methyl (1R,2S,5R)-5-methyl-1-(3-methylbut-3-enyl)-2-prop-2-enoyl-2-trimethylsilyloxycyclopentane-1-carboxylate (PubChem CID 134960855) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is methyl (1R,2S,5R)-5-methyl-1-(3-methylbut-3-enyl)-2-prop-2-enoyl-2-trimethylsilyloxycyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,5R)-5-methyl-1-(3-methylbut-3-enyl)-2-prop-2-enoyl-2-trimethylsilyloxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134960855 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | methyl (1R,2S,5R)-5-methyl-1-(3-methylbut-3-enyl)-2-prop-2-enoyl-2-trimethylsilyloxycyclopentane-1-carboxylate |
| SMILES | C=CC(=O)[C@]1(O[Si](C)(C)C)CC[C@@H](C)[C@@]1(CCC(=C)C)C(=O)OC |
| InChI | InChI=1S/C19H32O4Si/c1-9-16(20)19(23-24(6,7)8)13-11-15(4)18(19,17(21)22-5)12-10-14(2)3/h9,15H,1-2,10-13H2,3-8H3/t15-,18+,19-/m1/s1 |
| InChIKey | NIQSSRKLJJXAGC-AYOQOUSVSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|