C36H28F6N2 — CID 134961149
12,25-ditert-butyl-7,20-bis(trifluoromethyl)-3,16-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2,4(9),5,7,10(28),11,13,15,17(22),18,20,23(27),24-tetradecaene (PubChem CID 134961149) has the molecular formula C36H28F6N2 and a molecular weight of 602.62 g/mol. Its IUPAC name is 12,25-ditert-butyl-7,20-bis(trifluoromethyl)-3,16-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2,4(9),5,7,10(28),11,13,15,17(22),18,20,23(27),24-tetradecaene.
| Compound Name | 12,25-ditert-butyl-7,20-bis(trifluoromethyl)-3,16-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2,4(9),5,7,10(28),11,13,15,17(22),18,20,23(27),24-tetradecaene |
|---|---|
| PubChem CID | 134961149 |
| Molecular Formula | C36H28F6N2 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 12,25-ditert-butyl-7,20-bis(trifluoromethyl)-3,16-diazaheptacyclo[13.11.1.12,10.04,9.017,22.023,27.014,28]octacosa-1(26),2,4(9),5,7,10(28),11,13,15,17(22),18,20,23(27),24-tetradecaene |
| SMILES | CC(C)(C)c1cc2c3cc(C(F)(F)F)ccc3nc3c4cc(C(C)(C)C)cc5c6cc(C(F)(F)F)ccc6nc(c(c1)c23)c54 |
| InChI | InChI=1S/C36H28F6N2/c1-33(2,3)19-13-23-21-11-17(35(37,38)39)7-9-27(21)44-32-26-16-20(34(4,5)6)14-24-22-12-18(36(40,41)42)8-10-28(22)43-31(30(24)26)25(15-19)29(23)32/h7-16H,1-6H3 |
| InChIKey | USTDEWVCQFXVMA-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|