C14H16F3NO3 — CID 134961498
tert-butyl N-[3-[(2S)-2-(trifluoromethyl)oxiran-2-yl]phenyl]carbamate (PubChem CID 134961498) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is tert-butyl N-[3-[(2S)-2-(trifluoromethyl)oxiran-2-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2S)-2-(trifluoromethyl)oxiran-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 134961498 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | tert-butyl N-[3-[(2S)-2-(trifluoromethyl)oxiran-2-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc([C@@]2(C(F)(F)F)CO2)c1 |
| InChI | InChI=1S/C14H16F3NO3/c1-12(2,3)21-11(19)18-10-6-4-5-9(7-10)13(8-20-13)14(15,16)17/h4-7H,8H2,1-3H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | FYKSSGQWXVVBPY-CYBMUJFWSA-N |
| XLogP | 3.82 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|