C19H28O3 — CID 134961745
methyl (2Z)-2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-ylidene]acetate (PubChem CID 134961745) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl (2Z)-2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-ylidene]acetate |
|---|---|
| PubChem CID | 134961745 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | methyl (2Z)-2-[(3S,6R)-2-ethenyl-3,6,8-triethyl-5-oxatricyclo[4.2.1.03,9]nonan-4-ylidene]acetate |
| SMILES | C=CC1C2C(CC)C[C@@]3(CC)O/C(=C\C(=O)OC)[C@]1(CC)C23 |
| InChI | InChI=1S/C19H28O3/c1-6-12-11-18(8-3)17-16(12)13(7-2)19(17,9-4)14(22-18)10-15(20)21-5/h7,10,12-13,16-17H,2,6,8-9,11H2,1,3-5H3/b14-10-/t12?,13?,16?,17?,18-,19-/m1/s1 |
| InChIKey | ATJNKPDKWLKIOW-CWOGBZNTSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|