C20H23F7N2O6 — CID 134962106
methyl (2S)-3-[4-acetamido-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 134962106) has the molecular formula C20H23F7N2O6 and a molecular weight of 520.40 g/mol. Its IUPAC name is methyl (2S)-3-[4-acetamido-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2S)-3-[4-acetamido-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 134962106 |
| Molecular Formula | C20H23F7N2O6 |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | methyl (2S)-3-[4-acetamido-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(NC(C)=O)c(OC(F)(C(F)(F)F)C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23F7N2O6/c1-10(30)28-12-7-6-11(8-13(15(31)33-5)29-16(32)35-17(2,3)4)9-14(12)34-18(21,19(22,23)24)20(25,26)27/h6-7,9,13H,8H2,1-5H3,(H,28,30)(H,29,32)/t13-/m0/s1 |
| InChIKey | HNFYHBFVBXZNGY-ZDUSSCGKSA-N |
| XLogP | 4.42 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |