C23H19FO6S2 — CID 134962243
(3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-fluoro-2H-chromen-4-one (PubChem CID 134962243) has the molecular formula C23H19FO6S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-fluoro-2H-chromen-4-one.
| Compound Name | (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-fluoro-2H-chromen-4-one |
|---|---|
| PubChem CID | 134962243 |
| Molecular Formula | C23H19FO6S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (3R)-3-[2,2-bis(benzenesulfonyl)ethyl]-3-fluoro-2H-chromen-4-one |
| SMILES | O=C1c2ccccc2OC[C@]1(F)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19FO6S2/c24-23(16-30-20-14-8-7-13-19(20)22(23)25)15-21(31(26,27)17-9-3-1-4-10-17)32(28,29)18-11-5-2-6-12-18/h1-14,21H,15-16H2/t23-/m1/s1 |
| InChIKey | VWTUZAAWGWBMOK-HSZRJFAPSA-N |
| XLogP | 3.63 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |