C25H29NO2 — CID 134962580
2,2-diethoxy-N-[(R)-phenyl-(4-phenylphenyl)methyl]ethanamine (PubChem CID 134962580) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2,2-diethoxy-N-[(R)-phenyl-(4-phenylphenyl)methyl]ethanamine.
| Compound Name | 2,2-diethoxy-N-[(R)-phenyl-(4-phenylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 134962580 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2,2-diethoxy-N-[(R)-phenyl-(4-phenylphenyl)methyl]ethanamine |
| SMILES | CCOC(CN[C@H](c1ccccc1)c1ccc(-c2ccccc2)cc1)OCC |
| InChI | InChI=1S/C25H29NO2/c1-3-27-24(28-4-2)19-26-25(22-13-9-6-10-14-22)23-17-15-21(16-18-23)20-11-7-5-8-12-20/h5-18,24-26H,3-4,19H2,1-2H3/t25-/m1/s1 |
| InChIKey | LOKQNVWAZSSOEI-RUZDIDTESA-N |
| XLogP | 5.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|