C21H22F3NO2 — CID 134962958
tert-butyl N-[(E)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 134962958) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is tert-butyl N-[(E)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 134962958 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl N-[(E)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO2/c1-20(2,3)27-19(26)25-18(14-9-15-7-5-4-6-8-15)16-10-12-17(13-11-16)21(22,23)24/h4-14,18H,1-3H3,(H,25,26)/b14-9+ |
| InChIKey | KOSGELJGGWXYIG-NTEUORMPSA-N |
| XLogP | 5.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |