C15H15NOSi — CID 134963270
2-(2,2-dimethyl-1,2-benzoxasilin-3-yl)pyridine (PubChem CID 134963270) has the molecular formula C15H15NOSi and a molecular weight of 253.38 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,2-benzoxasilin-3-yl)pyridine.
| Compound Name | 2-(2,2-dimethyl-1,2-benzoxasilin-3-yl)pyridine |
|---|---|
| PubChem CID | 134963270 |
| Molecular Formula | C15H15NOSi |
| Molecular Weight | 253.38 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2,2-dimethyl-1,2-benzoxasilin-3-yl)pyridine |
| SMILES | C[Si]1(C)Oc2ccccc2C=C1c1ccccn1 |
| InChI | InChI=1S/C15H15NOSi/c1-18(2)15(13-8-5-6-10-16-13)11-12-7-3-4-9-14(12)17-18/h3-11H,1-2H3 |
| InChIKey | FSZFZGCFJKMTHD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|