C12H20Zr — CID 134963413
4,5-diethylocta-3,5-diene;zirconium(2+) (PubChem CID 134963413) has the molecular formula C12H20Zr and a molecular weight of 255.52 g/mol. Its IUPAC name is 4,5-diethylocta-3,5-diene;zirconium(2+).
| Compound Name | 4,5-diethylocta-3,5-diene;zirconium(2+) |
|---|---|
| PubChem CID | 134963413 |
| Molecular Formula | C12H20Zr |
| Molecular Weight | 255.52 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4,5-diethylocta-3,5-diene;zirconium(2+) |
| SMILES | CC/[C-]=C(CC)/C(=[C-]/CC)CC.[Zr+2] |
| InChI | InChI=1S/C12H20.Zr/c1-5-9-11(7-3)12(8-4)10-6-2;/h5-8H2,1-4H3;/q-2;+2 |
| InChIKey | CLQILOPMASSSMA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|