C12H20O2S — CID 134963480
ethyl 6-(2,5-dihydrothiophen-2-yl)hexanoate (PubChem CID 134963480) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is ethyl 6-(2,5-dihydrothiophen-2-yl)hexanoate.
| Compound Name | ethyl 6-(2,5-dihydrothiophen-2-yl)hexanoate |
|---|---|
| PubChem CID | 134963480 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | ethyl 6-(2,5-dihydrothiophen-2-yl)hexanoate |
| SMILES | CCOC(=O)CCCCCC1C=CCS1 |
| InChI | InChI=1S/C12H20O2S/c1-2-14-12(13)9-5-3-4-7-11-8-6-10-15-11/h6,8,11H,2-5,7,9-10H2,1H3 |
| InChIKey | RWMAVQIMUVVLMH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|