C11H18O2 — CID 134964196
(5S)-8,8-dimethyl-6-oxaspiro[4.5]decan-4-one (PubChem CID 134964196) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (5S)-8,8-dimethyl-6-oxaspiro[4.5]decan-4-one.
| Compound Name | (5S)-8,8-dimethyl-6-oxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 134964196 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (5S)-8,8-dimethyl-6-oxaspiro[4.5]decan-4-one |
| SMILES | CC1(C)CC[C@]2(CCCC2=O)OC1 |
| InChI | InChI=1S/C11H18O2/c1-10(2)6-7-11(13-8-10)5-3-4-9(11)12/h3-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | HHGPGADRXQCTIY-NSHDSACASA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |