C17H22O3 — CID 134964266
ethyl (1S,4R,5R)-4-benzyl-5-hydroxy-2,5-dimethylcyclopent-2-ene-1-carboxylate (PubChem CID 134964266) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl (1S,4R,5R)-4-benzyl-5-hydroxy-2,5-dimethylcyclopent-2-ene-1-carboxylate.
| Compound Name | ethyl (1S,4R,5R)-4-benzyl-5-hydroxy-2,5-dimethylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 134964266 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | ethyl (1S,4R,5R)-4-benzyl-5-hydroxy-2,5-dimethylcyclopent-2-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(C)=C[C@@H](Cc2ccccc2)[C@@]1(C)O |
| InChI | InChI=1S/C17H22O3/c1-4-20-16(18)15-12(2)10-14(17(15,3)19)11-13-8-6-5-7-9-13/h5-10,14-15,19H,4,11H2,1-3H3/t14-,15+,17+/m0/s1 |
| InChIKey | FWFZETHCBNCAHR-ZMSDIMECSA-N |
| XLogP | 2.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|