C13H15F3NO- — CID 134964944
2,2,2-trifluoro-N-[2-(2-propylphenyl)ethyl]ethanimidate (PubChem CID 134964944) has the molecular formula C13H15F3NO- and a molecular weight of 258.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-propylphenyl)ethyl]ethanimidate.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-propylphenyl)ethyl]ethanimidate |
|---|---|
| PubChem CID | 134964944 |
| Molecular Formula | C13H15F3NO- |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-propylphenyl)ethyl]ethanimidate |
| SMILES | CCCc1ccccc1CC/N=C(\[O-])C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO/c1-2-5-10-6-3-4-7-11(10)8-9-17-12(18)13(14,15)16/h3-4,6-7H,2,5,8-9H2,1H3,(H,17,18)/p-1 |
| InChIKey | XBDFRQQABKXRLQ-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|