C13H22O5 — CID 134965306
(8R)-6-[(3S)-3-hydroxybutyl]-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 134965306) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (8R)-6-[(3S)-3-hydroxybutyl]-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (8R)-6-[(3S)-3-hydroxybutyl]-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 134965306 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (8R)-6-[(3S)-3-hydroxybutyl]-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | C[C@H](O)CCC1=C[C@@H](O)C2OC(C)(C)OCC2O1 |
| InChI | InChI=1S/C13H22O5/c1-8(14)4-5-9-6-10(15)12-11(17-9)7-16-13(2,3)18-12/h6,8,10-12,14-15H,4-5,7H2,1-3H3/t8-,10+,11?,12?/m0/s1 |
| InChIKey | NVQMVWIXQTUSQS-UMDRPBGHSA-N |
| XLogP | 0.94 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |