C12H19FO4 — CID 134965392
trans-diethyl (1S,2S)-4-fluorocyclohexane-1,2-dicarboxylate (PubChem CID 134965392) has the molecular formula C12H19FO4 and a molecular weight of 246.28 g/mol. Its IUPAC name is trans-diethyl (1S,2S)-4-fluorocyclohexane-1,2-dicarboxylate.
| Compound Name | trans-diethyl (1S,2S)-4-fluorocyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134965392 |
| Molecular Formula | C12H19FO4 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | trans-diethyl (1S,2S)-4-fluorocyclohexane-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CCC(F)C[C@@H]1C(=O)OCC |
| InChI | InChI=1S/C12H19FO4/c1-3-16-11(14)9-6-5-8(13)7-10(9)12(15)17-4-2/h8-10H,3-7H2,1-2H3/t8?,9-,10-/m0/s1 |
| InChIKey | SLDWTBKRSILBBV-AGROOBSYSA-N |
| XLogP | 1.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |