C15H24O — CID 134965926
(3R,3aR,6S,6aS)-3-[(Z)-but-2-en-2-yl]-1,3a,6,6a-tetramethyl-3,6-dihydro-1H-cyclopenta[c]furan (PubChem CID 134965926) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (3R,3aR,6S,6aS)-3-[(Z)-but-2-en-2-yl]-1,3a,6,6a-tetramethyl-3,6-dihydro-1H-cyclopenta[c]furan.
| Compound Name | (3R,3aR,6S,6aS)-3-[(Z)-but-2-en-2-yl]-1,3a,6,6a-tetramethyl-3,6-dihydro-1H-cyclopenta[c]furan |
|---|---|
| PubChem CID | 134965926 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3R,3aR,6S,6aS)-3-[(Z)-but-2-en-2-yl]-1,3a,6,6a-tetramethyl-3,6-dihydro-1H-cyclopenta[c]furan |
| SMILES | C/C=C(/C)[C@H]1OC(C)[C@@]2(C)[C@@H](C)C=C[C@@]12C |
| InChI | InChI=1S/C15H24O/c1-7-10(2)13-14(5)9-8-11(3)15(14,6)12(4)16-13/h7-9,11-13H,1-6H3/b10-7-/t11-,12?,13+,14-,15+/m0/s1 |
| InChIKey | KMKQZLRSMSZQPZ-CJSDDUBUSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|