C12H16O3 — CID 134966055
(4aS,11aR)-2,3,4a,5,8,9,10,11-octahydrobenzo[i][1,4]benzodioxin-6-one (PubChem CID 134966055) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (4aS,11aR)-2,3,4a,5,8,9,10,11-octahydrobenzo[i][1,4]benzodioxin-6-one.
| Compound Name | (4aS,11aR)-2,3,4a,5,8,9,10,11-octahydrobenzo[i][1,4]benzodioxin-6-one |
|---|---|
| PubChem CID | 134966055 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (4aS,11aR)-2,3,4a,5,8,9,10,11-octahydrobenzo[i][1,4]benzodioxin-6-one |
| SMILES | O=C1C=C2CCCC[C@@]23OCCO[C@H]3C1 |
| InChI | InChI=1S/C12H16O3/c13-10-7-9-3-1-2-4-12(9)11(8-10)14-5-6-15-12/h7,11H,1-6,8H2/t11-,12+/m0/s1 |
| InChIKey | BFKQLMHQODXJHB-NWDGAFQWSA-N |
| XLogP | 1.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |