C11H14O3 — CID 155934442
(4aS,10aR)-3,4a,5,8,9,10-hexahydro-2H-cyclopenta[i][1,4]benzodioxin-6-one (PubChem CID 155934442) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (4aS,10aR)-3,4a,5,8,9,10-hexahydro-2H-cyclopenta[i][1,4]benzodioxin-6-one.
| Compound Name | (4aS,10aR)-3,4a,5,8,9,10-hexahydro-2H-cyclopenta[i][1,4]benzodioxin-6-one |
|---|---|
| PubChem CID | 155934442 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (4aS,10aR)-3,4a,5,8,9,10-hexahydro-2H-cyclopenta[i][1,4]benzodioxin-6-one |
| SMILES | O=C1C=C2CCC[C@@]23OCCO[C@H]3C1 |
| InChI | InChI=1S/C11H14O3/c12-9-6-8-2-1-3-11(8)10(7-9)13-4-5-14-11/h6,10H,1-5,7H2/t10-,11+/m0/s1 |
| InChIKey | DDRYTNMSZMFVRN-WDEREUQCSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |