C11H16F3NO3 — CID 134966129
trifluoromethyl (2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 134966129) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is trifluoromethyl (2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | trifluoromethyl (2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 134966129 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | trifluoromethyl (2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | O=C(OC(F)(F)F)N1[C@H](CO)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C11H16F3NO3/c12-11(13,14)18-10(17)15-8(6-16)5-7-3-1-2-4-9(7)15/h7-9,16H,1-6H2/t7-,8-,9-/m0/s1 |
| InChIKey | ILTMXGIFIMZHDE-CIUDSAMLSA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |