C11H16F3NO2 — CID 135059588
1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone (PubChem CID 135059588) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 135059588 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1[C@H](CO)C[C@@H]2CCCC[C@@H]21)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2/c12-11(13,14)10(17)15-8(6-16)5-7-3-1-2-4-9(7)15/h7-9,16H,1-6H2/t7-,8-,9-/m0/s1 |
| InChIKey | KITJAAJNPOLCFH-CIUDSAMLSA-N |
| XLogP | 1.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |