C15H31NO2 — CID 157037935
ethane;1-[2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]ethanone (PubChem CID 157037935) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;1-[2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]ethanone.
| Compound Name | ethane;1-[2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 157037935 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | ethane;1-[2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]ethanone |
| SMILES | CC.CC.CC(=O)N1C(CO)CC2CCCCC21 |
| InChI | InChI=1S/C11H19NO2.2C2H6/c1-8(14)12-10(7-13)6-9-4-2-3-5-11(9)12;2*1-2/h9-11,13H,2-7H2,1H3;2*1-2H3 |
| InChIKey | VBTVOBWRALLGDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |