C10H18Br2O2 — CID 134966243
methyl (2R,3S)-2,3-dibromononanoate (PubChem CID 134966243) has the molecular formula C10H18Br2O2 and a molecular weight of 330.06 g/mol. Its IUPAC name is methyl (2R,3S)-2,3-dibromononanoate.
| Compound Name | methyl (2R,3S)-2,3-dibromononanoate |
|---|---|
| PubChem CID | 134966243 |
| Molecular Formula | C10H18Br2O2 |
| Molecular Weight | 330.06 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | methyl (2R,3S)-2,3-dibromononanoate |
| SMILES | CCCCCC[C@H](Br)[C@H](Br)C(=O)OC |
| InChI | InChI=1S/C10H18Br2O2/c1-3-4-5-6-7-8(11)9(12)10(13)14-2/h8-9H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | ADIKCPDPNLQOOP-IUCAKERBSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|