C11H16NO- — CID 134966484
(1Z)-1-[2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]propan-1-olate (PubChem CID 134966484) has the molecular formula C11H16NO- and a molecular weight of 178.25 g/mol. Its IUPAC name is (1Z)-1-[2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]propan-1-olate.
| Compound Name | (1Z)-1-[2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]propan-1-olate |
|---|---|
| PubChem CID | 134966484 |
| Molecular Formula | C11H16NO- |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (1Z)-1-[2-[(dimethylamino)methyl]cyclopenta-2,4-dien-1-ylidene]propan-1-olate |
| SMILES | CC/C([O-])=C1\C=CC=C1CN(C)C |
| InChI | InChI=1S/C11H17NO/c1-4-11(13)10-7-5-6-9(10)8-12(2)3/h5-7,13H,4,8H2,1-3H3/p-1/b11-10- |
| InChIKey | NTFQRIQMIPENCP-KHPPLWFESA-M |
| XLogP | 1.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|